C34H23FIrN3O- — CID 162503281
8-[4-(4-fluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine;iridium;2-phenylpyridine (PubChem CID 162503281) has the molecular formula C34H23FIrN3O- and a molecular weight of 700.79 g/mol. Its IUPAC name is 8-[4-(4-fluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine;iridium;2-phenylpyridine.
| Compound Name | 8-[4-(4-fluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 162503281 |
| Molecular Formula | C34H23FIrN3O- |
| Molecular Weight | 700.79 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | 8-[4-(4-fluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine;iridium;2-phenylpyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3cc(-c4ccc(F)cc4)ccn3)cccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C23H15FN2O.C11H8N.Ir/c1-14-5-10-19-18-3-2-4-20(22(18)27-23(19)26-14)21-13-16(11-12-25-21)15-6-8-17(24)9-7-15;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-13H,1H3;1-6,8-9H;/q;-1; |
| InChIKey | VODPQIJDQYRDGW-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.79 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|