C11H14F4O5S2 — CID 162504044
1,1,2,2-tetrafluoro-4-(7-thiabicyclo[2.2.1]heptane-2-carbonyloxy)butane-1-sulfonic acid (PubChem CID 162504044) has the molecular formula C11H14F4O5S2 and a molecular weight of 366.35 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-(7-thiabicyclo[2.2.1]heptane-2-carbonyloxy)butane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-(7-thiabicyclo[2.2.1]heptane-2-carbonyloxy)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 162504044 |
| Molecular Formula | C11H14F4O5S2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-(7-thiabicyclo[2.2.1]heptane-2-carbonyloxy)butane-1-sulfonic acid |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)O)C1CC2CCC1S2 |
| InChI | InChI=1S/C11H14F4O5S2/c12-10(13,11(14,15)22(17,18)19)3-4-20-9(16)7-5-6-1-2-8(7)21-6/h6-8H,1-5H2,(H,17,18,19) |
| InChIKey | CEJFIOPLUMDORH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|