C18H25F2O8S- — CID 162504073
2-[[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 162504073) has the molecular formula C18H25F2O8S- and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 162504073 |
| Molecular Formula | C18H25F2O8S- |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[[5,6-bis(1-hydroxycyclopentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]oxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(OC1CC2OC1C(C1(O)CCCC1)C2C1(O)CCCC1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C18H26F2O8S/c19-18(20,29(24,25)26)15(21)28-11-9-10-12(16(22)5-1-2-6-16)13(14(11)27-10)17(23)7-3-4-8-17/h10-14,22-23H,1-9H2,(H,24,25,26)/p-1 |
| InChIKey | BCPMACUYARJOQG-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|