C34H34F3IN6O6 — CID 162504197
N-[3-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 162504197) has the molecular formula C34H34F3IN6O6 and a molecular weight of 806.58 g/mol. Its IUPAC name is N-[3-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 162504197 |
| Molecular Formula | C34H34F3IN6O6 |
| Molecular Weight | 806.58 g/mol |
| Exact Mass | 806.15 |
| IUPAC Name | N-[3-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]pentylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C34H34F3IN6O6/c35-24-9-8-22(30(29(24)37)41-26-10-5-19(38)17-25(26)36)31(46)43-50-16-4-14-39-13-2-1-3-15-40-20-6-7-21-23(18-20)34(49)44(33(21)48)27-11-12-28(45)42-32(27)47/h5-10,17-18,27,39-41H,1-4,11-16H2,(H,43,46)(H,42,45,47) |
| InChIKey | LFUHJJGXFKMZGD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|