C32H30F3IN6O6 — CID 162504245
N-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 162504245) has the molecular formula C32H30F3IN6O6 and a molecular weight of 778.53 g/mol. Its IUPAC name is N-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 162504245 |
| Molecular Formula | C32H30F3IN6O6 |
| Molecular Weight | 778.53 g/mol |
| Exact Mass | 778.12 |
| IUPAC Name | N-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H30F3IN6O6/c33-22-7-6-20(28(27(22)35)39-24-8-3-17(36)15-23(24)34)29(44)41-48-14-2-12-37-11-1-13-38-18-4-5-19-21(16-18)32(47)42(31(19)46)25-9-10-26(43)40-30(25)45/h3-8,15-16,25,37-39H,1-2,9-14H2,(H,41,44)(H,40,43,45) |
| InChIKey | QMPJUZNKPMVSDX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|