C33H32F3IN6O6 — CID 162504302
N-[3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 162504302) has the molecular formula C33H32F3IN6O6 and a molecular weight of 792.55 g/mol. Its IUPAC name is N-[3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 162504302 |
| Molecular Formula | C33H32F3IN6O6 |
| Molecular Weight | 792.55 g/mol |
| Exact Mass | 792.14 |
| IUPAC Name | N-[3-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H32F3IN6O6/c34-23-8-7-21(29(28(23)36)40-25-9-4-18(37)16-24(25)35)30(45)42-49-15-3-13-38-12-1-2-14-39-19-5-6-20-22(17-19)33(48)43(32(20)47)26-10-11-27(44)41-31(26)46/h4-9,16-17,26,38-40H,1-3,10-15H2,(H,42,45)(H,41,44,46) |
| InChIKey | VPSWWSSMGFZZQS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|