C37H40F3IN6O6 — CID 162504355
N-[3-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]octylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 162504355) has the molecular formula C37H40F3IN6O6 and a molecular weight of 848.66 g/mol. Its IUPAC name is N-[3-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]octylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]octylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 162504355 |
| Molecular Formula | C37H40F3IN6O6 |
| Molecular Weight | 848.66 g/mol |
| Exact Mass | 848.20 |
| IUPAC Name | N-[3-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]octylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCCCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C37H40F3IN6O6/c38-27-12-11-25(33(32(27)40)44-29-13-8-22(41)20-28(29)39)34(49)46-53-19-7-17-42-16-5-3-1-2-4-6-18-43-23-9-10-24-26(21-23)37(52)47(36(24)51)30-14-15-31(48)45-35(30)50/h8-13,20-21,30,42-44H,1-7,14-19H2,(H,46,49)(H,45,48,50) |
| InChIKey | FQAZCUJPCSJDTG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|