C36H38F3IN6O6 — CID 162504421
N-[3-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 162504421) has the molecular formula C36H38F3IN6O6 and a molecular weight of 834.63 g/mol. Its IUPAC name is N-[3-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | N-[3-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 162504421 |
| Molecular Formula | C36H38F3IN6O6 |
| Molecular Weight | 834.63 g/mol |
| Exact Mass | 834.18 |
| IUPAC Name | N-[3-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]heptylamino]propoxy]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCCCNCCCONC(=O)c4ccc(F)c(F)c4Nc4ccc(I)cc4F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H38F3IN6O6/c37-26-11-10-24(32(31(26)39)43-28-12-7-21(40)19-27(28)38)33(48)45-52-18-6-16-41-15-4-2-1-3-5-17-42-22-8-9-23-25(20-22)36(51)46(35(23)50)29-13-14-30(47)44-34(29)49/h7-12,19-20,29,41-43H,1-6,13-18H2,(H,45,48)(H,44,47,49) |
| InChIKey | IJDYDLVZHXXAHB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|