C18H19N3O5S — CID 162506121
2-methoxy-4-(2-methoxyethoxy)-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide (PubChem CID 162506121) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-methoxy-4-(2-methoxyethoxy)-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide.
| Compound Name | 2-methoxy-4-(2-methoxyethoxy)-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 162506121 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-methoxy-4-(2-methoxyethoxy)-N-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]benzamide |
| SMILES | COCCOc1ccc(C(=O)NCc2nnc(-c3cccs3)o2)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O5S/c1-23-7-8-25-12-5-6-13(14(10-12)24-2)17(22)19-11-16-20-21-18(26-16)15-4-3-9-27-15/h3-6,9-10H,7-8,11H2,1-2H3,(H,19,22) |
| InChIKey | LAWHHSHHLUKMCU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|