C33H26IrNO2- — CID 162506224
(Z)-1-[4-(4-ethenylphenyl)phenyl]-3-hydroxybut-2-en-1-one;iridium;1-phenylisoquinoline (PubChem CID 162506224) has the molecular formula C33H26IrNO2- and a molecular weight of 660.79 g/mol. Its IUPAC name is (Z)-1-[4-(4-ethenylphenyl)phenyl]-3-hydroxybut-2-en-1-one;iridium;1-phenylisoquinoline.
| Compound Name | (Z)-1-[4-(4-ethenylphenyl)phenyl]-3-hydroxybut-2-en-1-one;iridium;1-phenylisoquinoline |
|---|---|
| PubChem CID | 162506224 |
| Molecular Formula | C33H26IrNO2- |
| Molecular Weight | 660.79 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | (Z)-1-[4-(4-ethenylphenyl)phenyl]-3-hydroxybut-2-en-1-one;iridium;1-phenylisoquinoline |
| SMILES | C=Cc1ccc(-c2ccc(C(=O)/C=C(/C)O)cc2)cc1.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C18H16O2.C15H10N.Ir/c1-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18(20)12-13(2)19;1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h3-12,19H,1H2,2H3;1-7,9-11H;/q;-1;/b13-12-;; |
| InChIKey | DDXDHISUQOKWRC-RWYDNECBSA-N |
| XLogP | 8.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.79 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|