C17H27BN3O4 — CID 162506400
CID 162506400 (PubChem CID 162506400) has the molecular formula C17H27BN3O4 and a molecular weight of 348.23 g/mol.
| Compound Name | CID 162506400 |
|---|---|
| PubChem CID | 162506400 |
| Molecular Formula | C17H27BN3O4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | — |
| SMILES | CCC(C)C(=O)NCCCNCCC(=O)Nc1cccc(O[B]O)c1 |
| InChI | InChI=1S/C17H27BN3O4/c1-3-13(2)17(23)20-10-5-9-19-11-8-16(22)21-14-6-4-7-15(12-14)25-18-24/h4,6-7,12-13,19,24H,3,5,8-11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | ZSQKPZNKVYBLNR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|