About oxolan-3-yl 3-phenylprop-2-enoate
oxolan-3-yl 3-phenylprop-2-enoate (PubChem CID 162506502) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is oxolan-3-yl 3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | oxolan-3-yl 3-phenylprop-2-enoate |
| PubChem CID | 162506502 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | oxolan-3-yl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OC1CCOC1 |
| InChI | InChI=1S/C13H14O3/c14-13(16-12-8-9-15-10-12)7-6-11-4-2-1-3-5-11/h1-7,12H,8-10H2 |
| InChIKey | NWWIVUSAXZMRDO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl 3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 3-phenylprop-2-enoate?
The IUPAC name of oxolan-3-yl 3-phenylprop-2-enoate (CID 162506502) is oxolan-3-yl 3-phenylprop-2-enoate.
What is the SMILES notation for oxolan-3-yl 3-phenylprop-2-enoate?
The canonical SMILES for oxolan-3-yl 3-phenylprop-2-enoate is O=C(C=Cc1ccccc1)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 3-phenylprop-2-enoate?
The InChIKey is NWWIVUSAXZMRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c14-13(16-12-8-9-15-10-12)7-6-11-4-2-1-3-5-11/h1-7,12H,8-10H2.
What are the key properties of oxolan-3-yl 3-phenylprop-2-enoate?
oxolan-3-yl 3-phenylprop-2-enoate has a molecular weight of 218.25 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 3-phenylprop-2-enoate is sourced from PubChem (CID 162506502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).