C24H27N7 — CID 162506529
6-[5-ethyl-3-[1-(2-isocyanoethyl)piperidin-4-yl]-2H-indazol-6-yl]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 162506529) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 6-[5-ethyl-3-[1-(2-isocyanoethyl)piperidin-4-yl]-2H-indazol-6-yl]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[5-ethyl-3-[1-(2-isocyanoethyl)piperidin-4-yl]-2H-indazol-6-yl]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 162506529 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 6-[5-ethyl-3-[1-(2-isocyanoethyl)piperidin-4-yl]-2H-indazol-6-yl]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | [C-]#[N+]CCN1CCC(c2[nH]nc3cc(-c4cc(C)c5ncnn5c4)c(CC)cc23)CC1 |
| InChI | InChI=1S/C24H27N7/c1-4-17-12-21-22(13-20(17)19-11-16(2)24-26-15-27-31(24)14-19)28-29-23(21)18-5-8-30(9-6-18)10-7-25-3/h11-15,18H,4-10H2,1-2H3,(H,28,29) |
| InChIKey | CEYVUGQJJBBJPO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|