C30H41N5O2 — CID 162506662
(2S)-6-methyl-N-[(1S)-1-[5-(1-methylindol-3-yl)-1H-imidazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 162506662) has the molecular formula C30H41N5O2 and a molecular weight of 503.69 g/mol. Its IUPAC name is (2S)-6-methyl-N-[(1S)-1-[5-(1-methylindol-3-yl)-1H-imidazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-6-methyl-N-[(1S)-1-[5-(1-methylindol-3-yl)-1H-imidazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 162506662 |
| Molecular Formula | C30H41N5O2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | (2S)-6-methyl-N-[(1S)-1-[5-(1-methylindol-3-yl)-1H-imidazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CC12CCN(C)CC2)c1ncc(-c2cn(C)c3ccccc23)[nH]1 |
| InChI | InChI=1S/C30H41N5O2/c1-4-21(36)10-6-5-7-12-25(33-29(37)24-18-30(24)14-16-34(2)17-15-30)28-31-19-26(32-28)23-20-35(3)27-13-9-8-11-22(23)27/h8-9,11,13,19-20,24-25H,4-7,10,12,14-18H2,1-3H3,(H,31,32)(H,33,37)/t24-,25+/m1/s1 |
| InChIKey | TWXZUFPTRMFTBN-RPBOFIJWSA-N |
| XLogP | 5.39 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|