C30H37FN4O3 — CID 162506722
(2S)-N-[(1S)-1-[5-(7-fluoro-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 162506722) has the molecular formula C30H37FN4O3 and a molecular weight of 520.65 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-[5-(7-fluoro-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-[(1S)-1-[5-(7-fluoro-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 162506722 |
| Molecular Formula | C30H37FN4O3 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2S)-N-[(1S)-1-[5-(7-fluoro-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]-7-oxononyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)[C@H]1CC12CCNCC2)c1ncc(-c2cc3ccc(C)nc3cc2F)o1 |
| InChI | InChI=1S/C30H37FN4O3/c1-3-21(36)7-5-4-6-8-25(35-28(37)23-17-30(23)11-13-32-14-12-30)29-33-18-27(38-29)22-15-20-10-9-19(2)34-26(20)16-24(22)31/h9-10,15-16,18,23,25,32H,3-8,11-14,17H2,1-2H3,(H,35,37)/t23-,25+/m1/s1 |
| InChIKey | AHFLDRZVJHRTTD-NOZRDPDXSA-N |
| XLogP | 5.81 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|