C21H18F6N8O2 — CID 162507073
5-[1-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]-N-(dimethylaminomethylidene)-1-pyrimidin-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 162507073) has the molecular formula C21H18F6N8O2 and a molecular weight of 528.42 g/mol. Its IUPAC name is 5-[1-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]-N-(dimethylaminomethylidene)-1-pyrimidin-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[1-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]-N-(dimethylaminomethylidene)-1-pyrimidin-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162507073 |
| Molecular Formula | C21H18F6N8O2 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 5-[1-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethyl]-N-(dimethylaminomethylidene)-1-pyrimidin-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1nc(C(=O)/N=C/N(C)C)nn1-c1ncccn1 |
| InChI | InChI=1S/C21H18F6N8O2/c1-11(31-17(36)12-7-13(20(22,23)24)9-14(8-12)21(25,26)27)16-32-15(18(37)30-10-34(2)3)33-35(16)19-28-5-4-6-29-19/h4-11H,1-3H3,(H,31,36)/b30-10+ |
| InChIKey | WXIKVLZUDNZFEX-WXMAUWIXSA-N |
| XLogP | 3.32 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|