About 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole
1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole (PubChem CID 162507701) has the molecular formula C16H15Cl2N
and a molecular weight of 292.21 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole |
| PubChem CID | 162507701 |
| Molecular Formula | C16H15Cl2N |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole |
| SMILES | CC1c2ccccc2N(c2cccc(Cl)c2Cl)C1C |
| InChI | InChI=1S/C16H15Cl2N/c1-10-11(2)19(14-8-4-3-6-12(10)14)15-9-5-7-13(17)16(15)18/h3-11H,1-2H3 |
| InChIKey | IAGCNEDNCIKJEU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole?
The IUPAC name of 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole (CID 162507701) is 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole.
What is the SMILES notation for 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole?
The canonical SMILES for 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole is CC1c2ccccc2N(c2cccc(Cl)c2Cl)C1C.
What is the InChIKey of 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole?
The InChIKey is IAGCNEDNCIKJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2N/c1-10-11(2)19(14-8-4-3-6-12(10)14)15-9-5-7-13(17)16(15)18/h3-11H,1-2H3.
What are the key properties of 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole?
1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole has a molecular weight of 292.21 g/mol, XLogP of 5.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dichlorophenyl)-2,3-dimethyl-2,3-dihydroindole is sourced from PubChem (CID 162507701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).