C24H40F11NO5Si5 — CID 162507895
N-[3-[dimethyl-[3-tris(dimethylsilyloxy)silylpropyl]silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide (PubChem CID 162507895) has the molecular formula C24H40F11NO5Si5 and a molecular weight of 771.99 g/mol. Its IUPAC name is N-[3-[dimethyl-[3-tris(dimethylsilyloxy)silylpropyl]silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide.
| Compound Name | N-[3-[dimethyl-[3-tris(dimethylsilyloxy)silylpropyl]silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 162507895 |
| Molecular Formula | C24H40F11NO5Si5 |
| Molecular Weight | 771.99 g/mol |
| Exact Mass | 771.16 |
| IUPAC Name | N-[3-[dimethyl-[3-tris(dimethylsilyloxy)silylpropyl]silyl]phenyl]-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
| SMILES | CN(C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1cccc([Si](C)(C)CCC[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C)c1 |
| InChI | InChI=1S/C24H40F11NO5Si5/c1-36(19(37)20(25,22(28,29)30)38-24(34,35)21(26,27)23(31,32)33)17-12-10-13-18(16-17)45(8,9)14-11-15-46(39-42(2)3,40-43(4)5)41-44(6)7/h10,12-13,16,42-44H,11,14-15H2,1-9H3 |
| InChIKey | MBXTXRPPEUTQDJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.99 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|