(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate

C10H17Br2NO2 — CID 162508064

IUPAC(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate
SMILESCN1CCCC(C)(OC(=O)C(Br)CBr)C1
InChIInChI=1S/C10H17Br2NO2/c1-10(4-3-5-13(2)7-10)15-9(14)8(12)6-11/h8H,3-7H2,1-2H3
InChIKeyOCHQUTHDEJZGDP-UHFFFAOYSA-N
MW343.06 g/mol
LogP2.17
Rot. Bonds3

About (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate

(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate (PubChem CID 162508064) has the molecular formula C10H17Br2NO2 and a molecular weight of 343.06 g/mol. Its IUPAC name is (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate.

Molecular Properties

Compound Name(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate
PubChem CID162508064
Molecular FormulaC10H17Br2NO2
Molecular Weight343.06 g/mol
Exact Mass340.96
IUPAC Name(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate
SMILESCN1CCCC(C)(OC(=O)C(Br)CBr)C1
InChIInChI=1S/C10H17Br2NO2/c1-10(4-3-5-13(2)7-10)15-9(14)8(12)6-11/h8H,3-7H2,1-2H3
InChIKeyOCHQUTHDEJZGDP-UHFFFAOYSA-N
XLogP2.17
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.06
LogP ≤ 52.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate?
The IUPAC name of (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate (CID 162508064) is (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate.
What is the SMILES notation for (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate?
The canonical SMILES for (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate is CN1CCCC(C)(OC(=O)C(Br)CBr)C1.
What is the InChIKey of (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate?
The InChIKey is OCHQUTHDEJZGDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Br2NO2/c1-10(4-3-5-13(2)7-10)15-9(14)8(12)6-11/h8H,3-7H2,1-2H3.
What are the key properties of (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate?
(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate has a molecular weight of 343.06 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate is sourced from PubChem (CID 162508064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).