C10H17Br2NO2 — CID 162508064
(1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate (PubChem CID 162508064) has the molecular formula C10H17Br2NO2 and a molecular weight of 343.06 g/mol. Its IUPAC name is (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate.
| Compound Name | (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate |
|---|---|
| PubChem CID | 162508064 |
| Molecular Formula | C10H17Br2NO2 |
| Molecular Weight | 343.06 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | (1,3-dimethylpiperidin-3-yl) 2,3-dibromopropanoate |
| SMILES | CN1CCCC(C)(OC(=O)C(Br)CBr)C1 |
| InChI | InChI=1S/C10H17Br2NO2/c1-10(4-3-5-13(2)7-10)15-9(14)8(12)6-11/h8H,3-7H2,1-2H3 |
| InChIKey | OCHQUTHDEJZGDP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|