About 2-piperazin-1-ylethyl 2-bromopropanoate
2-piperazin-1-ylethyl 2-bromopropanoate (PubChem CID 162508420) has the molecular formula C9H17BrN2O2
and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-piperazin-1-ylethyl 2-bromopropanoate.
Molecular Properties
| Compound Name | 2-piperazin-1-ylethyl 2-bromopropanoate |
| PubChem CID | 162508420 |
| Molecular Formula | C9H17BrN2O2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-piperazin-1-ylethyl 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OCCN1CCNCC1 |
| InChI | InChI=1S/C9H17BrN2O2/c1-8(10)9(13)14-7-6-12-4-2-11-3-5-12/h8,11H,2-7H2,1H3 |
| InChIKey | MZWXWGDODIMGIP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylethyl 2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylethyl 2-bromopropanoate?
The IUPAC name of 2-piperazin-1-ylethyl 2-bromopropanoate (CID 162508420) is 2-piperazin-1-ylethyl 2-bromopropanoate.
What is the SMILES notation for 2-piperazin-1-ylethyl 2-bromopropanoate?
The canonical SMILES for 2-piperazin-1-ylethyl 2-bromopropanoate is CC(Br)C(=O)OCCN1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylethyl 2-bromopropanoate?
The InChIKey is MZWXWGDODIMGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrN2O2/c1-8(10)9(13)14-7-6-12-4-2-11-3-5-12/h8,11H,2-7H2,1H3.
What are the key properties of 2-piperazin-1-ylethyl 2-bromopropanoate?
2-piperazin-1-ylethyl 2-bromopropanoate has a molecular weight of 265.15 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylethyl 2-bromopropanoate is sourced from PubChem (CID 162508420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).