About (1-aminonaphthalen-2-yl) 2-bromopropanoate
(1-aminonaphthalen-2-yl) 2-bromopropanoate (PubChem CID 162508853) has the molecular formula C13H12BrNO2
and a molecular weight of 294.15 g/mol. Its IUPAC name is (1-aminonaphthalen-2-yl) 2-bromopropanoate.
Molecular Properties
| Compound Name | (1-aminonaphthalen-2-yl) 2-bromopropanoate |
| PubChem CID | 162508853 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (1-aminonaphthalen-2-yl) 2-bromopropanoate |
| SMILES | CC(Br)C(=O)Oc1ccc2ccccc2c1N |
| InChI | InChI=1S/C13H12BrNO2/c1-8(14)13(16)17-11-7-6-9-4-2-3-5-10(9)12(11)15/h2-8H,15H2,1H3 |
| InChIKey | HDHVRRTWOXEIQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (1-aminonaphthalen-2-yl) 2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminonaphthalen-2-yl) 2-bromopropanoate?
The IUPAC name of (1-aminonaphthalen-2-yl) 2-bromopropanoate (CID 162508853) is (1-aminonaphthalen-2-yl) 2-bromopropanoate.
What is the SMILES notation for (1-aminonaphthalen-2-yl) 2-bromopropanoate?
The canonical SMILES for (1-aminonaphthalen-2-yl) 2-bromopropanoate is CC(Br)C(=O)Oc1ccc2ccccc2c1N.
What is the InChIKey of (1-aminonaphthalen-2-yl) 2-bromopropanoate?
The InChIKey is HDHVRRTWOXEIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO2/c1-8(14)13(16)17-11-7-6-9-4-2-3-5-10(9)12(11)15/h2-8H,15H2,1H3.
What are the key properties of (1-aminonaphthalen-2-yl) 2-bromopropanoate?
(1-aminonaphthalen-2-yl) 2-bromopropanoate has a molecular weight of 294.15 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminonaphthalen-2-yl) 2-bromopropanoate is sourced from PubChem (CID 162508853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).