C14H13F6O5- — CID 162509209
2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 162509209) has the molecular formula C14H13F6O5- and a molecular weight of 375.24 g/mol. Its IUPAC name is 2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 162509209 |
| Molecular Formula | C14H13F6O5- |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxycarbonyl]-1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | O=C(OCCOC(=O)C([O-])(C(F)(F)F)C(F)(F)F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H13F6O5/c15-13(16,17)12(23,14(18,19)20)11(22)25-4-3-24-10(21)9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2/q-1 |
| InChIKey | HBKBRAHFJKBYCV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|