C13H15Br2NO2 — CID 162509229
(4-piperidin-4-ylphenyl) 2,2-dibromoacetate (PubChem CID 162509229) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is (4-piperidin-4-ylphenyl) 2,2-dibromoacetate.
| Compound Name | (4-piperidin-4-ylphenyl) 2,2-dibromoacetate |
|---|---|
| PubChem CID | 162509229 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | (4-piperidin-4-ylphenyl) 2,2-dibromoacetate |
| SMILES | O=C(Oc1ccc(C2CCNCC2)cc1)C(Br)Br |
| InChI | InChI=1S/C13H15Br2NO2/c14-12(15)13(17)18-11-3-1-9(2-4-11)10-5-7-16-8-6-10/h1-4,10,12,16H,5-8H2 |
| InChIKey | NJMBABOLBZVQTJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|