About [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate
[2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate (PubChem CID 162509449) has the molecular formula C18H28Br2NO2+
and a molecular weight of 450.24 g/mol. Its IUPAC name is [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate.
Molecular Properties
| Compound Name | [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate |
| PubChem CID | 162509449 |
| Molecular Formula | C18H28Br2NO2+ |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate |
| SMILES | C[NH+]1CCC(C2(OC(=O)C(Br)Br)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C18H27Br2NO2/c1-21-4-2-13(3-5-21)18(23-17(22)16(19)20)14-7-11-6-12(9-14)10-15(18)8-11/h11-16H,2-10H2,1H3/p+1 |
| InChIKey | NJTUHACBVXUTOU-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate?
The IUPAC name of [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate (CID 162509449) is [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate.
What is the SMILES notation for [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate?
The canonical SMILES for [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate is C[NH+]1CCC(C2(OC(=O)C(Br)Br)C3CC4CC(C3)CC2C4)CC1.
What is the InChIKey of [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate?
The InChIKey is NJTUHACBVXUTOU-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H27Br2NO2/c1-21-4-2-13(3-5-21)18(23-17(22)16(19)20)14-7-11-6-12(9-14)10-15(18)8-11/h11-16H,2-10H2,1H3/p+1.
What are the key properties of [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate?
[2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate has a molecular weight of 450.24 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-methylpiperidin-1-ium-4-yl)-2-adamantyl] 2,2-dibromoacetate is sourced from PubChem (CID 162509449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).