About 3,4-dimethoxyphenol
3,4-dimethoxyphenol (PubChem CID 16251) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,4-dimethoxyphenol.
Molecular Properties
| Compound Name | 3,4-dimethoxyphenol |
| PubChem CID | 16251 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,4-dimethoxyphenol |
| SMILES | COc1ccc(O)cc1OC |
| InChI | InChI=1S/C8H10O3/c1-10-7-4-3-6(9)5-8(7)11-2/h3-5,9H,1-2H3 |
| InChIKey | SMFFZOQLHYIRDA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxyphenol?
The IUPAC name of 3,4-dimethoxyphenol (CID 16251) is 3,4-dimethoxyphenol.
What is the SMILES notation for 3,4-dimethoxyphenol?
The canonical SMILES for 3,4-dimethoxyphenol is COc1ccc(O)cc1OC.
What is the InChIKey of 3,4-dimethoxyphenol?
The InChIKey is SMFFZOQLHYIRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-10-7-4-3-6(9)5-8(7)11-2/h3-5,9H,1-2H3.
What are the key properties of 3,4-dimethoxyphenol?
3,4-dimethoxyphenol has a molecular weight of 154.16 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxyphenol is sourced from PubChem (CID 16251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).