C11H15F3O — CID 162510008
(Z)-8,8,8-trifluoro-2,2-dimethyl-4-methylideneoct-5-en-3-one (PubChem CID 162510008) has the molecular formula C11H15F3O and a molecular weight of 220.23 g/mol. Its IUPAC name is (Z)-8,8,8-trifluoro-2,2-dimethyl-4-methylideneoct-5-en-3-one.
| Compound Name | (Z)-8,8,8-trifluoro-2,2-dimethyl-4-methylideneoct-5-en-3-one |
|---|---|
| PubChem CID | 162510008 |
| Molecular Formula | C11H15F3O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (Z)-8,8,8-trifluoro-2,2-dimethyl-4-methylideneoct-5-en-3-one |
| SMILES | C=C(/C=C\CC(F)(F)F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H15F3O/c1-8(9(15)10(2,3)4)6-5-7-11(12,13)14/h5-6H,1,7H2,2-4H3/b6-5- |
| InChIKey | QQOZIBNCAMWCSI-WAYWQWQTSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|