C21H24BrF3N4O2S — CID 162510299
5-[3-[4-(3-bromopropoxy)cyclohexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 162510299) has the molecular formula C21H24BrF3N4O2S and a molecular weight of 533.41 g/mol. Its IUPAC name is 5-[3-[4-(3-bromopropoxy)cyclohexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[3-[4-(3-bromopropoxy)cyclohexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 162510299 |
| Molecular Formula | C21H24BrF3N4O2S |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 5-[3-[4-(3-bromopropoxy)cyclohexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | CC1(C)C(=O)N(c2cnc(C#N)c(C(F)(F)F)c2)C(=S)N1C1CCC(OCCCBr)CC1 |
| InChI | InChI=1S/C21H24BrF3N4O2S/c1-20(2)18(30)28(14-10-16(21(23,24)25)17(11-26)27-12-14)19(32)29(20)13-4-6-15(7-5-13)31-9-3-8-22/h10,12-13,15H,3-9H2,1-2H3 |
| InChIKey | JMELVWGMNXGYQP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|