C17H7F7N4O2 — CID 162511091
6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one (PubChem CID 162511091) has the molecular formula C17H7F7N4O2 and a molecular weight of 432.26 g/mol. Its IUPAC name is 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one.
| Compound Name | 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 162511091 |
| Molecular Formula | C17H7F7N4O2 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one |
| SMILES | O=C1c2cc(-c3nnc(C(F)F)o3)ccc2CN1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H7F7N4O2/c18-8-9(19)11(21)13(12(22)10(8)20)27-28-4-6-2-1-5(3-7(6)17(28)29)15-25-26-16(30-15)14(23)24/h1-3,14,27H,4H2 |
| InChIKey | PUNRSPRZCWTBMA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|