C14H8F8OS — CID 162511306
2,2,3,3,3-pentafluoro-1-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 162511306) has the molecular formula C14H8F8OS and a molecular weight of 376.27 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 162511306 |
| Molecular Formula | C14H8F8OS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)(c1cccs1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F8OS/c15-12(16,17)9-4-1-3-8(7-9)11(23,10-5-2-6-24-10)13(18,19)14(20,21)22/h1-7,23H |
| InChIKey | VJFTURATCLXRSM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|