C13H8ClF5OS — CID 162511359
1-(3-chlorophenyl)-2,2,3,3,3-pentafluoro-1-thiophen-2-ylpropan-1-ol (PubChem CID 162511359) has the molecular formula C13H8ClF5OS and a molecular weight of 342.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,2,3,3,3-pentafluoro-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-2,2,3,3,3-pentafluoro-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511359 |
| Molecular Formula | C13H8ClF5OS |
| Molecular Weight | 342.72 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1-(3-chlorophenyl)-2,2,3,3,3-pentafluoro-1-thiophen-2-ylpropan-1-ol |
| SMILES | OC(c1cccc(Cl)c1)(c1cccs1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF5OS/c14-9-4-1-3-8(7-9)11(20,10-5-2-6-21-10)12(15,16)13(17,18)19/h1-7,20H |
| InChIKey | CAGXMDSNIGZLIU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|