C13H8F5NO3S — CID 162511361
2,2,3,3,3-pentafluoro-1-(4-nitrophenyl)-1-thiophen-2-ylpropan-1-ol (PubChem CID 162511361) has the molecular formula C13H8F5NO3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-nitrophenyl)-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-nitrophenyl)-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511361 |
| Molecular Formula | C13H8F5NO3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-nitrophenyl)-1-thiophen-2-ylpropan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(C(O)(c2cccs2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H8F5NO3S/c14-12(15,13(16,17)18)11(20,10-2-1-7-23-10)8-3-5-9(6-4-8)19(21)22/h1-7,20H |
| InChIKey | UGYZEYANFGSHOU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|