C12H8F5NOS — CID 162511527
2,2,3,3,3-pentafluoro-1-pyridin-2-yl-1-thiophen-3-ylpropan-1-ol (PubChem CID 162511527) has the molecular formula C12H8F5NOS and a molecular weight of 309.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-pyridin-2-yl-1-thiophen-3-ylpropan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-pyridin-2-yl-1-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511527 |
| Molecular Formula | C12H8F5NOS |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-pyridin-2-yl-1-thiophen-3-ylpropan-1-ol |
| SMILES | OC(c1ccsc1)(c1ccccn1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F5NOS/c13-11(14,12(15,16)17)10(19,8-4-6-20-7-8)9-3-1-2-5-18-9/h1-7,19H |
| InChIKey | MCRNKXQBJXCTFT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|