C17H15BrF5NO — CID 162511628
1-(2-bromophenyl)-1-[3-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 162511628) has the molecular formula C17H15BrF5NO and a molecular weight of 424.21 g/mol. Its IUPAC name is 1-(2-bromophenyl)-1-[3-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(2-bromophenyl)-1-[3-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 162511628 |
| Molecular Formula | C17H15BrF5NO |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 1-(2-bromophenyl)-1-[3-(dimethylamino)phenyl]-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | CN(C)c1cccc(C(O)(c2ccccc2Br)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15BrF5NO/c1-24(2)12-7-5-6-11(10-12)15(25,16(19,20)17(21,22)23)13-8-3-4-9-14(13)18/h3-10,25H,1-2H3 |
| InChIKey | ZIDQSBLHOXBWKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|