C13H8ClF5O2 — CID 162511679
1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-(furan-3-yl)propan-1-ol (PubChem CID 162511679) has the molecular formula C13H8ClF5O2 and a molecular weight of 326.65 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-(furan-3-yl)propan-1-ol.
| Compound Name | 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-(furan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 162511679 |
| Molecular Formula | C13H8ClF5O2 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(2-chlorophenyl)-2,2,3,3,3-pentafluoro-1-(furan-3-yl)propan-1-ol |
| SMILES | OC(c1ccoc1)(c1ccccc1Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8ClF5O2/c14-10-4-2-1-3-9(10)11(20,8-5-6-21-7-8)12(15,16)13(17,18)19/h1-7,20H |
| InChIKey | CBPPYFOAVPKSNJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|