C23H48BrN — CID 162511915
1,3-di(nonyl)piperidin-1-ium bromide (PubChem CID 162511915) has the molecular formula C23H48BrN and a molecular weight of 418.55 g/mol. Its IUPAC name is 1,3-di(nonyl)piperidin-1-ium bromide.
| Compound Name | 1,3-di(nonyl)piperidin-1-ium bromide |
|---|---|
| PubChem CID | 162511915 |
| Molecular Formula | C23H48BrN |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 1,3-di(nonyl)piperidin-1-ium bromide |
| SMILES | CCCCCCCCCC1CCC[NH+](CCCCCCCCC)C1.[Br-] |
| InChI | InChI=1S/C23H47N.BrH/c1-3-5-7-9-11-13-15-18-23-19-17-21-24(22-23)20-16-14-12-10-8-6-4-2;/h23H,3-22H2,1-2H3;1H |
| InChIKey | YXENSYMOVGWJPA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|