About 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate
9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate (PubChem CID 162512109) has the molecular formula C20H13ClN4O2S
and a molecular weight of 408.87 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate |
| PubChem CID | 162512109 |
| Molecular Formula | C20H13ClN4O2S |
| Molecular Weight | 408.87 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC1c2ccccc2-c2ccccc21)c1nc2cnc(Cl)nc2s1 |
| InChI | InChI=1S/C20H13ClN4O2S/c1-25(19-23-15-10-22-18(21)24-17(15)28-19)20(26)27-16-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16/h2-10,16H,1H3 |
| InChIKey | ROANZHUMJVCNEH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate?
The IUPAC name of 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate (CID 162512109) is 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate.
What is the SMILES notation for 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate?
The canonical SMILES for 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate is CN(C(=O)OC1c2ccccc2-c2ccccc21)c1nc2cnc(Cl)nc2s1.
What is the InChIKey of 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate?
The InChIKey is ROANZHUMJVCNEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClN4O2S/c1-25(19-23-15-10-22-18(21)24-17(15)28-19)20(26)27-16-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16/h2-10,16H,1H3.
What are the key properties of 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate?
9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate has a molecular weight of 408.87 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl N-(5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)-N-methylcarbamate is sourced from PubChem (CID 162512109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).