C18H21ClF2N2 — CID 162512220
(2S)-1-[bis(4-fluorophenyl)methyl]-2-methylpiperazine;hydrochloride (PubChem CID 162512220) has the molecular formula C18H21ClF2N2 and a molecular weight of 338.83 g/mol. Its IUPAC name is (2S)-1-[bis(4-fluorophenyl)methyl]-2-methylpiperazine;hydrochloride.
| Compound Name | (2S)-1-[bis(4-fluorophenyl)methyl]-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 162512220 |
| Molecular Formula | C18H21ClF2N2 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (2S)-1-[bis(4-fluorophenyl)methyl]-2-methylpiperazine;hydrochloride |
| SMILES | C[C@H]1CNCCN1C(c1ccc(F)cc1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C18H20F2N2.ClH/c1-13-12-21-10-11-22(13)18(14-2-6-16(19)7-3-14)15-4-8-17(20)9-5-15;/h2-9,13,18,21H,10-12H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | ZTRNRBRIXFIACO-ZOWNYOTGSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |