C19H32N2O7S — CID 162512945
methyl 4-oxo-4-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]butanoate (PubChem CID 162512945) has the molecular formula C19H32N2O7S and a molecular weight of 432.54 g/mol. Its IUPAC name is methyl 4-oxo-4-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]butanoate.
| Compound Name | methyl 4-oxo-4-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]butanoate |
|---|---|
| PubChem CID | 162512945 |
| Molecular Formula | C19H32N2O7S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | methyl 4-oxo-4-[2-[3-[[(4R)-2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl]amino]propanoylamino]ethylsulfanyl]butanoate |
| SMILES | COC(=O)CCC(=O)SCCNC(=O)CCNC(=O)[C@@H]1OC(C)(C)OCC1(C)C |
| InChI | InChI=1S/C19H32N2O7S/c1-18(2)12-27-19(3,4)28-16(18)17(25)21-9-8-13(22)20-10-11-29-15(24)7-6-14(23)26-5/h16H,6-12H2,1-5H3,(H,20,22)(H,21,25)/t16-/m0/s1 |
| InChIKey | CFLPARGQKQAUEC-INIZCTEOSA-N |
| XLogP | 1.00 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|