C26H36O6 — CID 162513485
6,8-dihydroxy-7-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethyl-9-(2-methylpropyl)-9H-xanthene-1,3-dione (PubChem CID 162513485) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is 6,8-dihydroxy-7-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethyl-9-(2-methylpropyl)-9H-xanthene-1,3-dione.
| Compound Name | 6,8-dihydroxy-7-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethyl-9-(2-methylpropyl)-9H-xanthene-1,3-dione |
|---|---|
| PubChem CID | 162513485 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 6,8-dihydroxy-7-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethyl-9-(2-methylpropyl)-9H-xanthene-1,3-dione |
| SMILES | CC(C)CC(O)c1c(O)cc2c(c1O)C(CC(C)C)C1=C(O2)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C26H36O6/c1-12(2)9-14-18-17(11-16(28)20(21(18)29)15(27)10-13(3)4)32-23-19(14)22(30)25(5,6)24(31)26(23,7)8/h11-15,27-29H,9-10H2,1-8H3 |
| InChIKey | FDTQFZPNGJCCAG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|