C22H26N4O2S — CID 162513552
4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 162513552) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 162513552 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-3-[1-[4-(2-methylpropyl)phenyl]ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(/C=N/n2c(C(C)c3ccc(CC(C)C)cc3)n[nH]c2=S)ccc1O |
| InChI | InChI=1S/C22H26N4O2S/c1-14(2)11-16-5-8-18(9-6-16)15(3)21-24-25-22(29)26(21)23-13-17-7-10-19(27)20(12-17)28-4/h5-10,12-15,27H,11H2,1-4H3,(H,25,29)/b23-13+ |
| InChIKey | JDZWMMDEGHHEKU-YDZHTSKRSA-N |
| XLogP | 4.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|