C30H26F5N7O5S — CID 162514345
1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-2,4-dioxo-3-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea (PubChem CID 162514345) has the molecular formula C30H26F5N7O5S and a molecular weight of 691.64 g/mol. Its IUPAC name is 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-2,4-dioxo-3-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea.
| Compound Name | 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-2,4-dioxo-3-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea |
|---|---|
| PubChem CID | 162514345 |
| Molecular Formula | C30H26F5N7O5S |
| Molecular Weight | 691.64 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-2,4-dioxo-3-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]thieno[2,3-d]pyrimidin-6-yl]phenyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1ccc(-c2sc3c(c2CN(C)C)c(=O)n(-c2ccc(OCC(F)(F)F)nn2)c(=O)n3Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C30H26F5N7O5S/c1-40(2)13-19-24-26(43)42(22-11-12-23(38-37-22)47-15-30(33,34)35)29(45)41(14-18-20(31)5-4-6-21(18)32)27(24)48-25(19)16-7-9-17(10-8-16)36-28(44)39-46-3/h4-12H,13-15H2,1-3H3,(H2,36,39,44) |
| InChIKey | KBSRPHVCAQMYOJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|