About 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid
2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid (PubChem CID 162514486) has the molecular formula C28H28O5
and a molecular weight of 444.53 g/mol. Its IUPAC name is 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid.
Molecular Properties
| Compound Name | 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid |
| PubChem CID | 162514486 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid |
| SMILES | COc1c(C)cc(-c2oc3cc(C)cc(C(=O)O)c3c2-c2cc(C)c(OC)c(C)c2)cc1C |
| InChI | InChI=1S/C28H28O5/c1-14-8-21(28(29)30)24-22(9-14)33-27(20-12-17(4)26(32-7)18(5)13-20)23(24)19-10-15(2)25(31-6)16(3)11-19/h8-13H,1-7H3,(H,29,30) |
| InChIKey | ZLNCELCKTUTRHI-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid?
The IUPAC name of 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid (CID 162514486) is 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid.
What is the SMILES notation for 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid?
The canonical SMILES for 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid is COc1c(C)cc(-c2oc3cc(C)cc(C(=O)O)c3c2-c2cc(C)c(OC)c(C)c2)cc1C.
What is the InChIKey of 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid?
The InChIKey is ZLNCELCKTUTRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28O5/c1-14-8-21(28(29)30)24-22(9-14)33-27(20-12-17(4)26(32-7)18(5)13-20)23(24)19-10-15(2)25(31-6)16(3)11-19/h8-13H,1-7H3,(H,29,30).
What are the key properties of 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid?
2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid has a molecular weight of 444.53 g/mol, XLogP of 7.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(4-methoxy-3,5-dimethylphenyl)-6-methyl-1-benzofuran-4-carboxylic acid is sourced from PubChem (CID 162514486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).