C17H12BrClN5O2S+ — CID 162515007
N-(6-bromo-2-pyridinyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide (PubChem CID 162515007) has the molecular formula C17H12BrClN5O2S+ and a molecular weight of 465.74 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 162515007 |
| Molecular Formula | C17H12BrClN5O2S+ |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)n1)c1c(O)[n+](Cc2cnc(Cl)s2)c2ccccn12 |
| InChI | InChI=1S/C17H11BrClN5O2S/c18-11-4-3-5-12(21-11)22-15(25)14-16(26)24(9-10-8-20-17(19)27-10)13-6-1-2-7-23(13)14/h1-8H,9H2,(H-,21,22,25,26)/p+1 |
| InChIKey | CSLVRMMLTFUQNH-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|