About 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile (PubChem CID 162515176) has the molecular formula C15H10FNO2
and a molecular weight of 255.25 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile |
| PubChem CID | 162515176 |
| Molecular Formula | C15H10FNO2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)OCCO3)c1F |
| InChI | InChI=1S/C15H10FNO2/c16-15-11(9-17)2-1-3-12(15)10-4-5-13-14(8-10)19-7-6-18-13/h1-5,8H,6-7H2 |
| InChIKey | RTMYFDNDCGKIAP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile?
The IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile (CID 162515176) is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile.
What is the SMILES notation for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile?
The canonical SMILES for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile is N#Cc1cccc(-c2ccc3c(c2)OCCO3)c1F.
What is the InChIKey of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile?
The InChIKey is RTMYFDNDCGKIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNO2/c16-15-11(9-17)2-1-3-12(15)10-4-5-13-14(8-10)19-7-6-18-13/h1-5,8H,6-7H2.
What are the key properties of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile?
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile has a molecular weight of 255.25 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluorobenzonitrile is sourced from PubChem (CID 162515176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).