C48H47F3N2O5 — CID 162515517
2-[3-methyl-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]phenyl]-5-(trifluoromethyl)pyrazine (PubChem CID 162515517) has the molecular formula C48H47F3N2O5 and a molecular weight of 788.91 g/mol. Its IUPAC name is 2-[3-methyl-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]phenyl]-5-(trifluoromethyl)pyrazine.
| Compound Name | 2-[3-methyl-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]phenyl]-5-(trifluoromethyl)pyrazine |
|---|---|
| PubChem CID | 162515517 |
| Molecular Formula | C48H47F3N2O5 |
| Molecular Weight | 788.91 g/mol |
| Exact Mass | 788.34 |
| IUPAC Name | 2-[3-methyl-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethyl]phenyl]-5-(trifluoromethyl)pyrazine |
| SMILES | Cc1cc(-c2cnc(C(F)(F)F)cn2)ccc1C(C)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H47F3N2O5/c1-33-25-39(41-26-53-43(27-52-41)48(49,50)51)23-24-40(33)34(2)44-46(56-30-37-19-11-5-12-20-37)47(57-31-38-21-13-6-14-22-38)45(55-29-36-17-9-4-10-18-36)42(58-44)32-54-28-35-15-7-3-8-16-35/h3-27,34,42,44-47H,28-32H2,1-2H3/t34?,42-,44-,45-,46-,47+/m1/s1 |
| InChIKey | HBVDPZVDTDLBGS-QHKGEJGPSA-N |
| XLogP | 10.31 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.91 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |