C49H47F3N2O5 — CID 162515533
2-[3-methyl-4-[(1R)-1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]phenyl]-5-(trifluoromethyl)pyrazine (PubChem CID 162515533) has the molecular formula C49H47F3N2O5 and a molecular weight of 800.92 g/mol. Its IUPAC name is 2-[3-methyl-4-[(1R)-1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]phenyl]-5-(trifluoromethyl)pyrazine.
| Compound Name | 2-[3-methyl-4-[(1R)-1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]phenyl]-5-(trifluoromethyl)pyrazine |
|---|---|
| PubChem CID | 162515533 |
| Molecular Formula | C49H47F3N2O5 |
| Molecular Weight | 800.92 g/mol |
| Exact Mass | 800.34 |
| IUPAC Name | 2-[3-methyl-4-[(1R)-1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]phenyl]-5-(trifluoromethyl)pyrazine |
| SMILES | C=C[C@H](c1ccc(-c2cnc(C(F)(F)F)cn2)cc1C)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H47F3N2O5/c1-3-40(41-25-24-39(26-34(41)2)42-27-54-44(28-53-42)49(50,51)52)45-47(57-31-37-20-12-6-13-21-37)48(58-32-38-22-14-7-15-23-38)46(56-30-36-18-10-5-11-19-36)43(59-45)33-55-29-35-16-8-4-9-17-35/h3-28,40,43,45-48H,1,29-33H2,2H3/t40-,43-,45-,46-,47-,48+/m1/s1 |
| InChIKey | XHHDDJLQTYEOLA-GRDKJFIASA-N |
| XLogP | 10.48 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.92 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|