C49H52BF3O7 — CID 162515537
4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 162515537) has the molecular formula C49H52BF3O7 and a molecular weight of 820.75 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162515537 |
| Molecular Formula | C49H52BF3O7 |
| Molecular Weight | 820.75 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-(trifluoromethyl)-4-[1-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | C=C(c1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(F)(F)F)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C49H52BF3O7/c1-34(40-27-26-39(28-41(40)49(51,52)53)50-59-47(2,3)48(4,5)60-50)43-45(56-31-37-22-14-8-15-23-37)46(57-32-38-24-16-9-17-25-38)44(55-30-36-20-12-7-13-21-36)42(58-43)33-54-29-35-18-10-6-11-19-35/h6-28,42-46H,1,29-33H2,2-5H3/t42-,43-,44-,45?,46+/m1/s1 |
| InChIKey | MYXYUZRFVMXMJS-YDCOXISOSA-N |
| XLogP | 9.76 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.75 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|