C14H15NO4 — CID 162515752
2-[3,4-bis(1,3-dioxol-2-yl)phenyl]ethanamine (PubChem CID 162515752) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[3,4-bis(1,3-dioxol-2-yl)phenyl]ethanamine.
| Compound Name | 2-[3,4-bis(1,3-dioxol-2-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 162515752 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[3,4-bis(1,3-dioxol-2-yl)phenyl]ethanamine |
| SMILES | NCCc1ccc(C2OC=CO2)c(C2OC=CO2)c1 |
| InChI | InChI=1S/C14H15NO4/c15-4-3-10-1-2-11(13-16-5-6-17-13)12(9-10)14-18-7-8-19-14/h1-2,5-9,13-14H,3-4,15H2 |
| InChIKey | VUIPKESAGBVCGX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |