C28H39FN4O5 — CID 162515920
(2S)-2-[[(2S)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide (PubChem CID 162515920) has the molecular formula C28H39FN4O5 and a molecular weight of 530.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 162515920 |
| Molecular Formula | C28H39FN4O5 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(E)-3-(3-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoyl]amino]-4-methyl-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)/C=C/c1cccc(F)c1)C(C)C)C(=O)N[C@H](C=O)C[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C28H39FN4O5/c1-17(2)13-23(27(37)31-22(16-34)15-20-8-6-12-30-26(20)36)32-28(38)25(18(3)4)33-24(35)11-10-19-7-5-9-21(29)14-19/h5,7,9-11,14,16-18,20,22-23,25H,6,8,12-13,15H2,1-4H3,(H,30,36)(H,31,37)(H,32,38)(H,33,35)/b11-10+/t20-,22-,23-,25-/m0/s1 |
| InChIKey | BSFWLBHHPMJDFU-OJKQOYALSA-N |
| XLogP | 2.11 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|