C24H30N8O2S — CID 162515958
13-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one (PubChem CID 162515958) has the molecular formula C24H30N8O2S and a molecular weight of 494.63 g/mol. Its IUPAC name is 13-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one.
| Compound Name | 13-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 162515958 |
| Molecular Formula | C24H30N8O2S |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 13-[2-ethoxy-4-(4-methylpiperazin-1-yl)anilino]-2,5,9-trimethyl-4-thia-2,6,9,12,14-pentazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-8-one |
| SMILES | CCOc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(n1)N(C)c1sc(C)nc1C(=O)N2C |
| InChI | InChI=1S/C24H30N8O2S/c1-6-34-19-13-16(32-11-9-29(3)10-12-32)7-8-17(19)27-24-25-14-18-21(28-24)31(5)23-20(22(33)30(18)4)26-15(2)35-23/h7-8,13-14H,6,9-12H2,1-5H3,(H,25,27,28) |
| InChIKey | MVAKEFGUPSUTBR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|